C19H22O4 — CID 87741549
1'-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2'-methylspiro[1,3-dioxolane-2,4'-naphthalene]-1'-ol (PubChem CID 87741549) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1'-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2'-methylspiro[1,3-dioxolane-2,4'-naphthalene]-1'-ol.
| Compound Name | 1'-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2'-methylspiro[1,3-dioxolane-2,4'-naphthalene]-1'-ol |
|---|---|
| PubChem CID | 87741549 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1'-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2'-methylspiro[1,3-dioxolane-2,4'-naphthalene]-1'-ol |
| SMILES | CC1=CC2(OCCO2)c2ccccc2C1(O)/C=C/C(C)=C/CO |
| InChI | InChI=1S/C19H22O4/c1-14(8-10-20)7-9-18(21)15(2)13-19(22-11-12-23-19)17-6-4-3-5-16(17)18/h3-9,13,20-21H,10-12H2,1-2H3/b9-7+,14-8+ |
| InChIKey | XGDMSMBVOOLCBK-AITIXOJYSA-N |
| XLogP | 2.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|