C25H30ClN7O3Si — CID 87741719
5-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-5-N-(5-chloro-2-pyridinyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 87741719) has the molecular formula C25H30ClN7O3Si and a molecular weight of 540.10 g/mol. Its IUPAC name is 5-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-5-N-(5-chloro-2-pyridinyl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 5-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-5-N-(5-chloro-2-pyridinyl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 87741719 |
| Molecular Formula | C25H30ClN7O3Si |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 5-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-5-N-(5-chloro-2-pyridinyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(C#N)c1ccc(N(C(=O)c2[nH]cnc2C(N)=O)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C25H30ClN7O3Si/c1-25(2,3)37(4,5)36-13-12-32(15-27)18-7-9-19(10-8-18)33(20-11-6-17(26)14-29-20)24(35)22-21(23(28)34)30-16-31-22/h6-11,14,16H,12-13H2,1-5H3,(H2,28,34)(H,30,31) |
| InChIKey | YZQSYWPWNZUKJR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|