C31H39ClN4O3 — CID 87741735
(4S)-19-chloro-4-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-8-methyl-11-oxa-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6(22),7,9,17,19-hexaen-2-one (PubChem CID 87741735) has the molecular formula C31H39ClN4O3 and a molecular weight of 551.13 g/mol. Its IUPAC name is (4S)-19-chloro-4-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-8-methyl-11-oxa-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6(22),7,9,17,19-hexaen-2-one.
| Compound Name | (4S)-19-chloro-4-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-8-methyl-11-oxa-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6(22),7,9,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 87741735 |
| Molecular Formula | C31H39ClN4O3 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (4S)-19-chloro-4-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-8-methyl-11-oxa-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6(22),7,9,17,19-hexaen-2-one |
| SMILES | Cc1cc2cc(c1)OCCCCNc1cc(cc(Cl)n1)C(=O)N[C@H]([C@H](O)CNCc1cccc(C(C)C)c1)C2 |
| InChI | InChI=1S/C31H39ClN4O3/c1-20(2)24-8-6-7-22(13-24)18-33-19-28(37)27-15-23-11-21(3)12-26(14-23)39-10-5-4-9-34-30-17-25(31(38)35-27)16-29(32)36-30/h6-8,11-14,16-17,20,27-28,33,37H,4-5,9-10,15,18-19H2,1-3H3,(H,34,36)(H,35,38)/t27-,28+/m0/s1 |
| InChIKey | LDOHDRJSTZHQOZ-WUFINQPMSA-N |
| XLogP | 5.24 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|