C24H16Cl2F2N4O2 — CID 87741954
5-[(E)-N-[(6-amino-2-pyridinyl)methoxy]-C-(2,4-difluorophenyl)carbonimidoyl]-1-(2,6-dichlorophenyl)pyridin-2-one (PubChem CID 87741954) has the molecular formula C24H16Cl2F2N4O2 and a molecular weight of 501.32 g/mol. Its IUPAC name is 5-[(E)-N-[(6-amino-2-pyridinyl)methoxy]-C-(2,4-difluorophenyl)carbonimidoyl]-1-(2,6-dichlorophenyl)pyridin-2-one.
| Compound Name | 5-[(E)-N-[(6-amino-2-pyridinyl)methoxy]-C-(2,4-difluorophenyl)carbonimidoyl]-1-(2,6-dichlorophenyl)pyridin-2-one |
|---|---|
| PubChem CID | 87741954 |
| Molecular Formula | C24H16Cl2F2N4O2 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 5-[(E)-N-[(6-amino-2-pyridinyl)methoxy]-C-(2,4-difluorophenyl)carbonimidoyl]-1-(2,6-dichlorophenyl)pyridin-2-one |
| SMILES | Nc1cccc(CO/N=C(\c2ccc(=O)n(-c3c(Cl)cccc3Cl)c2)c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C24H16Cl2F2N4O2/c25-18-4-2-5-19(26)24(18)32-12-14(7-10-22(32)33)23(17-9-8-15(27)11-20(17)28)31-34-13-16-3-1-6-21(29)30-16/h1-12H,13H2,(H2,29,30)/b31-23+ |
| InChIKey | LYCKLDZVGIGTBS-UQRQXUALSA-N |
| XLogP | 5.37 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|