About 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde
4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87741980) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 87741980 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCOC1=C(C)C(C)(OC)C(C=O)C=C1 |
| InChI | InChI=1S/C12H18O3/c1-5-15-11-7-6-10(8-13)12(3,14-4)9(11)2/h6-8,10H,5H2,1-4H3 |
| InChIKey | WPKZXIFSFJPFPB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde (CID 87741980) is 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde is CCOC1=C(C)C(C)(OC)C(C=O)C=C1.
What is the InChIKey of 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is WPKZXIFSFJPFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-5-15-11-7-6-10(8-13)12(3,14-4)9(11)2/h6-8,10H,5H2,1-4H3.
What are the key properties of 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde?
4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 210.27 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-6-methoxy-5,6-dimethylcyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 87741980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).