C34H34N14O4 — CID 87742066
N-[3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide;N-[4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide (PubChem CID 87742066) has the molecular formula C34H34N14O4 and a molecular weight of 702.74 g/mol. Its IUPAC name is N-[3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide;N-[4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide.
| Compound Name | N-[3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide;N-[4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide |
|---|---|
| PubChem CID | 87742066 |
| Molecular Formula | C34H34N14O4 |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 702.29 |
| IUPAC Name | N-[3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide;N-[4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]formamide |
| SMILES | Nc1nc(N2CCOCC2)c2nc(-c3ccc(NC=O)cc3)cnc2n1.Nc1nc(N2CCOCC2)c2nc(-c3cccc(NC=O)c3)cnc2n1 |
| InChI | InChI=1S/2C17H17N7O2/c18-17-22-15-14(16(23-17)24-5-7-26-8-6-24)21-13(9-19-15)11-1-3-12(4-2-11)20-10-25;18-17-22-15-14(16(23-17)24-4-6-26-7-5-24)21-13(9-19-15)11-2-1-3-12(8-11)20-10-25/h1-4,9-10H,5-8H2,(H,20,25)(H2,18,19,22,23);1-3,8-10H,4-7H2,(H,20,25)(H2,18,19,22,23) |
| InChIKey | DDIUNCRSGBYYLP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 238.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|