About (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide
(2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide (PubChem CID 87742250) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide.
Molecular Properties
| Compound Name | (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide |
| PubChem CID | 87742250 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)NCCO |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-8-9-12(15)13-10-11-14/h6-9,14H,2-5,10-11H2,1H3,(H,13,15)/b7-6+,9-8+ |
| InChIKey | GKQBTYJRRTWQCF-BLHCBFLLSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide?
The IUPAC name of (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide (CID 87742250) is (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide.
What is the SMILES notation for (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide?
The canonical SMILES for (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide is CCCCC/C=C/C=C/C(=O)NCCO.
What is the InChIKey of (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide?
The InChIKey is GKQBTYJRRTWQCF-BLHCBFLLSA-N. The full InChI is InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-8-9-12(15)13-10-11-14/h6-9,14H,2-5,10-11H2,1H3,(H,13,15)/b7-6+,9-8+.
What are the key properties of (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide?
(2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide has a molecular weight of 211.31 g/mol, XLogP of 1.79, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-N-(2-hydroxyethyl)deca-2,4-dienamide is sourced from PubChem (CID 87742250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).