C26H33FN6O4S2 — CID 87742340
4-[[4-(4-fluoro-3-methylanilino)pyrimidin-2-yl]amino]-N-methyl-N-[1-(2-sulfonylethyl)piperidin-4-yl]benzenesulfonamide;methane (PubChem CID 87742340) has the molecular formula C26H33FN6O4S2 and a molecular weight of 576.72 g/mol. Its IUPAC name is 4-[[4-(4-fluoro-3-methylanilino)pyrimidin-2-yl]amino]-N-methyl-N-[1-(2-sulfonylethyl)piperidin-4-yl]benzenesulfonamide;methane.
| Compound Name | 4-[[4-(4-fluoro-3-methylanilino)pyrimidin-2-yl]amino]-N-methyl-N-[1-(2-sulfonylethyl)piperidin-4-yl]benzenesulfonamide;methane |
|---|---|
| PubChem CID | 87742340 |
| Molecular Formula | C26H33FN6O4S2 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 4-[[4-(4-fluoro-3-methylanilino)pyrimidin-2-yl]amino]-N-methyl-N-[1-(2-sulfonylethyl)piperidin-4-yl]benzenesulfonamide;methane |
| SMILES | C.Cc1cc(Nc2ccnc(Nc3ccc(S(=O)(=O)N(C)C4CCN(CC=S(=O)=O)CC4)cc3)n2)ccc1F |
| InChI | InChI=1S/C25H29FN6O4S2.CH4/c1-18-17-20(5-8-23(18)26)28-24-9-12-27-25(30-24)29-19-3-6-22(7-4-19)38(35,36)31(2)21-10-13-32(14-11-21)15-16-37(33)34;/h3-9,12,16-17,21H,10-11,13-15H2,1-2H3,(H2,27,28,29,30);1H4 |
| InChIKey | XRPZKVFPOCSVKR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|