C41H52N4O4S — CID 87742554
2-[4-[[6-[[(2R)-1-[(2S)-2-amino-3-cyclohexylpropanoyl]sulfanyl-4-methylpentan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 87742554) has the molecular formula C41H52N4O4S and a molecular weight of 696.96 g/mol. Its IUPAC name is 2-[4-[[6-[[(2R)-1-[(2S)-2-amino-3-cyclohexylpropanoyl]sulfanyl-4-methylpentan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[6-[[(2R)-1-[(2S)-2-amino-3-cyclohexylpropanoyl]sulfanyl-4-methylpentan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87742554 |
| Molecular Formula | C41H52N4O4S |
| Molecular Weight | 696.96 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | 2-[4-[[6-[[(2R)-1-[(2S)-2-amino-3-cyclohexylpropanoyl]sulfanyl-4-methylpentan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCc1nc2c(C)cc(C(=O)N[C@@H](CSC(=O)[C@@H](N)CC3CCCCC3)CC(C)C)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C41H52N4O4S/c1-5-11-37-44-38-27(4)21-31(39(46)43-32(20-26(2)3)25-50-41(49)35(42)22-28-12-7-6-8-13-28)23-36(38)45(37)24-29-16-18-30(19-17-29)33-14-9-10-15-34(33)40(47)48/h9-10,14-19,21,23,26,28,32,35H,5-8,11-13,20,22,24-25,42H2,1-4H3,(H,43,46)(H,47,48)/t32-,35+/m1/s1 |
| InChIKey | UAQGUGHSZAGLCD-LDNVYYCDSA-N |
| XLogP | 8.41 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.96 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|