About 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide
6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide (PubChem CID 87742639) has the molecular formula C7H5ClF2N2O2
and a molecular weight of 222.58 g/mol. Its IUPAC name is 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide |
| PubChem CID | 87742639 |
| Molecular Formula | C7H5ClF2N2O2 |
| Molecular Weight | 222.58 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1c(F)cc(CCl)n(F)c1=O |
| InChI | InChI=1S/C7H5ClF2N2O2/c8-2-3-1-4(9)5(6(11)13)7(14)12(3)10/h1H,2H2,(H2,11,13) |
| InChIKey | APSLPJPSFGWYRB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.58 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide?
The IUPAC name of 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide (CID 87742639) is 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide.
What is the SMILES notation for 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide?
The canonical SMILES for 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide is NC(=O)c1c(F)cc(CCl)n(F)c1=O.
What is the InChIKey of 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide?
The InChIKey is APSLPJPSFGWYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF2N2O2/c8-2-3-1-4(9)5(6(11)13)7(14)12(3)10/h1H,2H2,(H2,11,13).
What are the key properties of 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide?
6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide has a molecular weight of 222.58 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-1,4-difluoro-2-oxopyridine-3-carboxamide is sourced from PubChem (CID 87742639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).