C26H18Cl2F5N3O5S — CID 87742916
1-[4-[1-(2,4-dichlorophenyl)-3-[(3,4-difluoro-2-hydroxyphenyl)carbamoyl]-4-methylpyrazol-5-yl]phenyl]-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 87742916) has the molecular formula C26H18Cl2F5N3O5S and a molecular weight of 650.41 g/mol. Its IUPAC name is 1-[4-[1-(2,4-dichlorophenyl)-3-[(3,4-difluoro-2-hydroxyphenyl)carbamoyl]-4-methylpyrazol-5-yl]phenyl]-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 1-[4-[1-(2,4-dichlorophenyl)-3-[(3,4-difluoro-2-hydroxyphenyl)carbamoyl]-4-methylpyrazol-5-yl]phenyl]-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87742916 |
| Molecular Formula | C26H18Cl2F5N3O5S |
| Molecular Weight | 650.41 g/mol |
| Exact Mass | 649.03 |
| IUPAC Name | 1-[4-[1-(2,4-dichlorophenyl)-3-[(3,4-difluoro-2-hydroxyphenyl)carbamoyl]-4-methylpyrazol-5-yl]phenyl]-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(F)c2O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C(CC(F)(F)F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H18Cl2F5N3O5S/c1-12-22(25(38)34-18-8-7-17(29)21(30)24(18)37)35-36(19-9-6-15(27)10-16(19)28)23(12)14-4-2-13(3-5-14)20(42(39,40)41)11-26(31,32)33/h2-10,20,37H,11H2,1H3,(H,34,38)(H,39,40,41) |
| InChIKey | TWBBTUOCXGOQBJ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.41 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|