C11H9F6NO2 — CID 87742929
1,1,1,3,3,3-hexafluoro-2-[4-[(E)-methoxyiminomethyl]phenyl]propan-2-ol (PubChem CID 87742929) has the molecular formula C11H9F6NO2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(E)-methoxyiminomethyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(E)-methoxyiminomethyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 87742929 |
| Molecular Formula | C11H9F6NO2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(E)-methoxyiminomethyl]phenyl]propan-2-ol |
| SMILES | CO/N=C/c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F6NO2/c1-20-18-6-7-2-4-8(5-3-7)9(19,10(12,13)14)11(15,16)17/h2-6,19H,1H3/b18-6+ |
| InChIKey | NCVFTBLEKLCNHL-NGYBGAFCSA-N |
| XLogP | 2.98 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|