C27H54OS — CID 87743498
2,2-dioctylundecanethioic S-acid (PubChem CID 87743498) has the molecular formula C27H54OS and a molecular weight of 426.80 g/mol. Its IUPAC name is 2,2-dioctylundecanethioic S-acid.
| Compound Name | 2,2-dioctylundecanethioic S-acid |
|---|---|
| PubChem CID | 87743498 |
| Molecular Formula | C27H54OS |
| Molecular Weight | 426.80 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 2,2-dioctylundecanethioic S-acid |
| SMILES | CCCCCCCCCC(CCCCCCCC)(CCCCCCCC)C(=O)S |
| InChI | InChI=1S/C27H54OS/c1-4-7-10-13-16-19-22-25-27(26(28)29,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-25H2,1-3H3,(H,28,29) |
| InChIKey | PWAPFBZDUZGURJ-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.80 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|