About 1-decoxy-1,2-dipropylhydrazine
1-decoxy-1,2-dipropylhydrazine (PubChem CID 87743617) has the molecular formula C16H36N2O
and a molecular weight of 272.48 g/mol. Its IUPAC name is 1-decoxy-1,2-dipropylhydrazine.
Molecular Properties
| Compound Name | 1-decoxy-1,2-dipropylhydrazine |
| PubChem CID | 87743617 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 1-decoxy-1,2-dipropylhydrazine |
| SMILES | CCCCCCCCCCON(CCC)NCCC |
| InChI | InChI=1S/C16H36N2O/c1-4-7-8-9-10-11-12-13-16-19-18(15-6-3)17-14-5-2/h17H,4-16H2,1-3H3 |
| InChIKey | DHNAWMVCNLBLED-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-decoxy-1,2-dipropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decoxy-1,2-dipropylhydrazine?
The IUPAC name of 1-decoxy-1,2-dipropylhydrazine (CID 87743617) is 1-decoxy-1,2-dipropylhydrazine.
What is the SMILES notation for 1-decoxy-1,2-dipropylhydrazine?
The canonical SMILES for 1-decoxy-1,2-dipropylhydrazine is CCCCCCCCCCON(CCC)NCCC.
What is the InChIKey of 1-decoxy-1,2-dipropylhydrazine?
The InChIKey is DHNAWMVCNLBLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N2O/c1-4-7-8-9-10-11-12-13-16-19-18(15-6-3)17-14-5-2/h17H,4-16H2,1-3H3.
What are the key properties of 1-decoxy-1,2-dipropylhydrazine?
1-decoxy-1,2-dipropylhydrazine has a molecular weight of 272.48 g/mol, XLogP of 4.69, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decoxy-1,2-dipropylhydrazine is sourced from PubChem (CID 87743617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).