C25H19Cl2F3N4O3S — CID 87743633
[3-[6-amino-8-[3-(3,5-dichlorophenyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] trifluoromethanesulfonate (PubChem CID 87743633) has the molecular formula C25H19Cl2F3N4O3S and a molecular weight of 583.42 g/mol. Its IUPAC name is [3-[6-amino-8-[3-(3,5-dichlorophenyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[6-amino-8-[3-(3,5-dichlorophenyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87743633 |
| Molecular Formula | C25H19Cl2F3N4O3S |
| Molecular Weight | 583.42 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | [3-[6-amino-8-[3-(3,5-dichlorophenyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] trifluoromethanesulfonate |
| SMILES | NC1=NC(c2cccc(OS(=O)(=O)C(F)(F)F)c2)(c2cccc(-c3cc(Cl)cc(Cl)c3)c2)C2=NCCCN12 |
| InChI | InChI=1S/C25H19Cl2F3N4O3S/c26-19-11-16(12-20(27)14-19)15-4-1-5-17(10-15)24(22-32-8-3-9-34(22)23(31)33-24)18-6-2-7-21(13-18)37-38(35,36)25(28,29)30/h1-2,4-7,10-14H,3,8-9H2,(H2,31,33) |
| InChIKey | JDCPQIKVMYKYRO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|