C22H22O5S — CID 87744419
2-hydroxy-1-(2-methylphenyl)-2-phenylethanone;4-methylbenzenesulfonic acid (PubChem CID 87744419) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-hydroxy-1-(2-methylphenyl)-2-phenylethanone;4-methylbenzenesulfonic acid.
| Compound Name | 2-hydroxy-1-(2-methylphenyl)-2-phenylethanone;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87744419 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-hydroxy-1-(2-methylphenyl)-2-phenylethanone;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccccc1C(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H14O2.C7H8O3S/c1-11-7-5-6-10-13(11)15(17)14(16)12-8-3-2-4-9-12;1-6-2-4-7(5-3-6)11(8,9)10/h2-10,14,16H,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | XNPHLAMQNDVRCW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|