C27H29F6N3O2S — CID 87744547
3-morpholin-4-yl-1-[4-[3-(piperidin-4-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 87744547) has the molecular formula C27H29F6N3O2S and a molecular weight of 573.60 g/mol. Its IUPAC name is 3-morpholin-4-yl-1-[4-[3-(piperidin-4-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 3-morpholin-4-yl-1-[4-[3-(piperidin-4-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 87744547 |
| Molecular Formula | C27H29F6N3O2S |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 3-morpholin-4-yl-1-[4-[3-(piperidin-4-ylmethylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCOCC1)c1ccc(Sc2cccc(NCC3CCNCC3)c2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C27H29F6N3O2S/c28-26(29,30)24-21(22(37)8-11-36-12-14-38-15-13-36)4-5-23(25(24)27(31,32)33)39-20-3-1-2-19(16-20)35-17-18-6-9-34-10-7-18/h1-5,8,11,16,18,34-35H,6-7,9-10,12-15,17H2 |
| InChIKey | RBCSLTIEOHVOGD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|