C23H30N4O3 — CID 8774504
(2R)-N-(2-ethoxyphenyl)-2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]-2-phenylacetamide (PubChem CID 8774504) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2R)-N-(2-ethoxyphenyl)-2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-(2-ethoxyphenyl)-2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 8774504 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (2R)-N-(2-ethoxyphenyl)-2-[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](c1ccccc1)N1CCN(CC(=O)NC)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-3-30-20-12-8-7-11-19(20)25-23(29)22(18-9-5-4-6-10-18)27-15-13-26(14-16-27)17-21(28)24-2/h4-12,22H,3,13-17H2,1-2H3,(H,24,28)(H,25,29)/t22-/m1/s1 |
| InChIKey | LQSUMFRHZGLOGM-JOCHJYFZSA-N |
| XLogP | 2.13 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |