About 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile
2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile (PubChem CID 87746055) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile.
Molecular Properties
| Compound Name | 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile |
| PubChem CID | 87746055 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile |
| SMILES | C=CCC(CC=C)C(O)(C#N)CC#N |
| InChI | InChI=1S/C11H14N2O/c1-3-5-10(6-4-2)11(14,9-13)7-8-12/h3-4,10,14H,1-2,5-7H2 |
| InChIKey | YQNYETITSPHKFT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile?
The IUPAC name of 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile (CID 87746055) is 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile.
What is the SMILES notation for 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile?
The canonical SMILES for 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile is C=CCC(CC=C)C(O)(C#N)CC#N.
What is the InChIKey of 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile?
The InChIKey is YQNYETITSPHKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-3-5-10(6-4-2)11(14,9-13)7-8-12/h3-4,10,14H,1-2,5-7H2.
What are the key properties of 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile?
2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile has a molecular weight of 190.25 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hepta-1,6-dien-4-yl-2-hydroxybutanedinitrile is sourced from PubChem (CID 87746055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).