C31H33N3O5S — CID 87746134
[5-[2-(1H-indol-5-yl)-5-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carbonyl]phenyl]-5-oxopentyl] methanesulfonate (PubChem CID 87746134) has the molecular formula C31H33N3O5S and a molecular weight of 559.69 g/mol. Its IUPAC name is [5-[2-(1H-indol-5-yl)-5-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carbonyl]phenyl]-5-oxopentyl] methanesulfonate.
| Compound Name | [5-[2-(1H-indol-5-yl)-5-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carbonyl]phenyl]-5-oxopentyl] methanesulfonate |
|---|---|
| PubChem CID | 87746134 |
| Molecular Formula | C31H33N3O5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | [5-[2-(1H-indol-5-yl)-5-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carbonyl]phenyl]-5-oxopentyl] methanesulfonate |
| SMILES | C[C@H]1CCN(C(=O)c2ccc(-c3ccc4[nH]ccc4c3)c(C(=O)CCCCOS(C)(=O)=O)c2)c2ccccc2N1 |
| InChI | InChI=1S/C31H33N3O5S/c1-21-15-17-34(29-8-4-3-7-28(29)33-21)31(36)24-10-12-25(22-11-13-27-23(19-22)14-16-32-27)26(20-24)30(35)9-5-6-18-39-40(2,37)38/h3-4,7-8,10-14,16,19-21,32-33H,5-6,9,15,17-18H2,1-2H3/t21-/m0/s1 |
| InChIKey | KVQRYLJCKZGXSM-NRFANRHFSA-N |
| XLogP | 6.01 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|