About 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde
1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde (PubChem CID 87746160) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde |
| PubChem CID | 87746160 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde |
| SMILES | CN1C(C=O)C=CC1(C)C=O |
| InChI | InChI=1S/C8H11NO2/c1-8(6-11)4-3-7(5-10)9(8)2/h3-7H,1-2H3 |
| InChIKey | HVKMNHDMCQWUAM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde?
The IUPAC name of 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde (CID 87746160) is 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde.
What is the SMILES notation for 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde?
The canonical SMILES for 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde is CN1C(C=O)C=CC1(C)C=O.
What is the InChIKey of 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde?
The InChIKey is HVKMNHDMCQWUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-8(6-11)4-3-7(5-10)9(8)2/h3-7H,1-2H3.
What are the key properties of 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde?
1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde has a molecular weight of 153.18 g/mol, XLogP of 0.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-2H-pyrrole-2,5-dicarbaldehyde is sourced from PubChem (CID 87746160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).