C19H34O — CID 87746163
6a-prop-2-enyl-2,3,3a,4,5,6-hexahydro-1H-pentalene;octanal (PubChem CID 87746163) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 6a-prop-2-enyl-2,3,3a,4,5,6-hexahydro-1H-pentalene;octanal.
| Compound Name | 6a-prop-2-enyl-2,3,3a,4,5,6-hexahydro-1H-pentalene;octanal |
|---|---|
| PubChem CID | 87746163 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 6a-prop-2-enyl-2,3,3a,4,5,6-hexahydro-1H-pentalene;octanal |
| SMILES | C=CCC12CCCC1CCC2.CCCCCCCC=O |
| InChI | InChI=1S/C11H18.C8H16O/c1-2-7-11-8-3-5-10(11)6-4-9-11;1-2-3-4-5-6-7-8-9/h2,10H,1,3-9H2;8H,2-7H2,1H3 |
| InChIKey | SFNZXWSRIUEKMI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|