C17H13ClN2O6S2 — CID 87746690
N-(4-chloro-1,2-oxazol-3-yl)-2-[2-(6-methyl-3H-1,2-benzodioxol-5-yl)acetyl]thiophene-3-sulfonamide (PubChem CID 87746690) has the molecular formula C17H13ClN2O6S2 and a molecular weight of 440.89 g/mol. Its IUPAC name is N-(4-chloro-1,2-oxazol-3-yl)-2-[2-(6-methyl-3H-1,2-benzodioxol-5-yl)acetyl]thiophene-3-sulfonamide.
| Compound Name | N-(4-chloro-1,2-oxazol-3-yl)-2-[2-(6-methyl-3H-1,2-benzodioxol-5-yl)acetyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 87746690 |
| Molecular Formula | C17H13ClN2O6S2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | N-(4-chloro-1,2-oxazol-3-yl)-2-[2-(6-methyl-3H-1,2-benzodioxol-5-yl)acetyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1nocc1Cl)COO2 |
| InChI | InChI=1S/C17H13ClN2O6S2/c1-9-4-14-11(7-25-26-14)5-10(9)6-13(21)16-15(2-3-27-16)28(22,23)20-17-12(18)8-24-19-17/h2-5,8H,6-7H2,1H3,(H,19,20) |
| InChIKey | PZWJCHPVOBMYQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|