C25H36F6O2Si — CID 87746714
5-[1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]cyclopropyl]-1,1,1-trifluoro-2-(trifluoromethyl)pent-3-yn-2-ol (PubChem CID 87746714) has the molecular formula C25H36F6O2Si and a molecular weight of 510.64 g/mol. Its IUPAC name is 5-[1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]cyclopropyl]-1,1,1-trifluoro-2-(trifluoromethyl)pent-3-yn-2-ol.
| Compound Name | 5-[1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]cyclopropyl]-1,1,1-trifluoro-2-(trifluoromethyl)pent-3-yn-2-ol |
|---|---|
| PubChem CID | 87746714 |
| Molecular Formula | C25H36F6O2Si |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 5-[1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]cyclopropyl]-1,1,1-trifluoro-2-(trifluoromethyl)pent-3-yn-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@]2(C)C(C3(CC#CC(O)(C(F)(F)F)C(F)(F)F)CC3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H36F6O2Si/c1-20(2,3)34(5,6)33-18-9-7-12-21(4)17(18)10-11-19(21)22(15-16-22)13-8-14-23(32,24(26,27)28)25(29,30)31/h11,17-18,32H,7,9-10,12-13,15-16H2,1-6H3/t17-,18-,21+/m0/s1 |
| InChIKey | XWJGUCLPVWDGRM-BBTUJRGHSA-N |
| XLogP | 7.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|