About 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid
5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid (PubChem CID 87746730) has the molecular formula C23H22FNO5S2
and a molecular weight of 475.56 g/mol. Its IUPAC name is 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid |
| PubChem CID | 87746730 |
| Molecular Formula | C23H22FNO5S2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid |
| SMILES | CCN(Sc1ccc(Oc2ccc(F)cc2)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H22FNO5S2/c1-4-25(32(28,29)21-13-15(2)16(3)22(14-21)23(26)27)31-20-11-9-19(10-12-20)30-18-7-5-17(24)6-8-18/h5-14H,4H2,1-3H3,(H,26,27) |
| InChIKey | IOHHOJIEUYCZEW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid?
The IUPAC name of 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid (CID 87746730) is 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid.
What is the SMILES notation for 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid?
The canonical SMILES for 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid is CCN(Sc1ccc(Oc2ccc(F)cc2)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)O)c1.
What is the InChIKey of 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid?
The InChIKey is IOHHOJIEUYCZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FNO5S2/c1-4-25(32(28,29)21-13-15(2)16(3)22(14-21)23(26)27)31-20-11-9-19(10-12-20)30-18-7-5-17(24)6-8-18/h5-14H,4H2,1-3H3,(H,26,27).
What are the key properties of 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid?
5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid has a molecular weight of 475.56 g/mol, XLogP of 5.65, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl-[4-(4-fluorophenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoic acid is sourced from PubChem (CID 87746730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).