About nonan-5-one;propan-2-ol
nonan-5-one;propan-2-ol (PubChem CID 87747214) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is nonan-5-one;propan-2-ol.
Molecular Properties
| Compound Name | nonan-5-one;propan-2-ol |
| PubChem CID | 87747214 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | nonan-5-one;propan-2-ol |
| SMILES | CC(C)O.CCCCC(=O)CCCC |
| InChI | InChI=1S/C9H18O.C3H8O/c1-3-5-7-9(10)8-6-4-2;1-3(2)4/h3-8H2,1-2H3;3-4H,1-2H3 |
| InChIKey | RYKWSKLWHRUABI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze nonan-5-one;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-5-one;propan-2-ol?
The IUPAC name of nonan-5-one;propan-2-ol (CID 87747214) is nonan-5-one;propan-2-ol.
What is the SMILES notation for nonan-5-one;propan-2-ol?
The canonical SMILES for nonan-5-one;propan-2-ol is CC(C)O.CCCCC(=O)CCCC.
What is the InChIKey of nonan-5-one;propan-2-ol?
The InChIKey is RYKWSKLWHRUABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C3H8O/c1-3-5-7-9(10)8-6-4-2;1-3(2)4/h3-8H2,1-2H3;3-4H,1-2H3.
What are the key properties of nonan-5-one;propan-2-ol?
nonan-5-one;propan-2-ol has a molecular weight of 202.34 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-5-one;propan-2-ol is sourced from PubChem (CID 87747214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).