About 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol
4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol (PubChem CID 87747392) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol.
Molecular Properties
| Compound Name | 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol |
| PubChem CID | 87747392 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol |
| SMILES | C=CCC1(O)OCC(C=C)O1 |
| InChI | InChI=1S/C8H12O3/c1-3-5-8(9)10-6-7(4-2)11-8/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | CAZCYBHIBXHZQS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol?
The IUPAC name of 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol (CID 87747392) is 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol.
What is the SMILES notation for 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol?
The canonical SMILES for 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol is C=CCC1(O)OCC(C=C)O1.
What is the InChIKey of 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol?
The InChIKey is CAZCYBHIBXHZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-5-8(9)10-6-7(4-2)11-8/h3-4,7,9H,1-2,5-6H2.
What are the key properties of 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol?
4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol has a molecular weight of 156.18 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2-prop-2-enyl-1,3-dioxolan-2-ol is sourced from PubChem (CID 87747392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).