C29H31F2N3O4S — CID 87747397
(2S)-N-[5-[2-(cyclohexyloxymethyl)phenyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)-2-oxoacetyl]amino]pentanamide (PubChem CID 87747397) has the molecular formula C29H31F2N3O4S and a molecular weight of 555.65 g/mol. Its IUPAC name is (2S)-N-[5-[2-(cyclohexyloxymethyl)phenyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)-2-oxoacetyl]amino]pentanamide.
| Compound Name | (2S)-N-[5-[2-(cyclohexyloxymethyl)phenyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)-2-oxoacetyl]amino]pentanamide |
|---|---|
| PubChem CID | 87747397 |
| Molecular Formula | C29H31F2N3O4S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (2S)-N-[5-[2-(cyclohexyloxymethyl)phenyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)-2-oxoacetyl]amino]pentanamide |
| SMILES | CCC[C@H](NC(=O)C(=O)c1cc(F)cc(F)c1)C(=O)Nc1ncc(-c2ccccc2COC2CCCCC2)s1 |
| InChI | InChI=1S/C29H31F2N3O4S/c1-2-8-24(33-28(37)26(35)19-13-20(30)15-21(31)14-19)27(36)34-29-32-16-25(39-29)23-12-7-6-9-18(23)17-38-22-10-4-3-5-11-22/h6-7,9,12-16,22,24H,2-5,8,10-11,17H2,1H3,(H,33,37)(H,32,34,36)/t24-/m0/s1 |
| InChIKey | NXLWCMHVSWQZFH-DEOSSOPVSA-N |
| XLogP | 6.04 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|