C6H6Cl6Fe — CID 87747584
1,2,3,4,5,6-hexachlorocyclohexane;iron (PubChem CID 87747584) has the molecular formula C6H6Cl6Fe and a molecular weight of 346.68 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclohexane;iron.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclohexane;iron |
|---|---|
| PubChem CID | 87747584 |
| Molecular Formula | C6H6Cl6Fe |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 343.80 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane;iron |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.[Fe] |
| InChI | InChI=1S/C6H6Cl6.Fe/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h1-6H; |
| InChIKey | SBFFUTIMDUPFHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|