C12H10N2O3 — CID 87748176
3-amino-4-(2,3-dihydro-1,3-benzoxazol-5-ylmethyl)cyclobut-3-ene-1,2-dione (PubChem CID 87748176) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-amino-4-(2,3-dihydro-1,3-benzoxazol-5-ylmethyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(2,3-dihydro-1,3-benzoxazol-5-ylmethyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87748176 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-amino-4-(2,3-dihydro-1,3-benzoxazol-5-ylmethyl)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(Cc2ccc3c(c2)NCO3)c(=O)c1=O |
| InChI | InChI=1S/C12H10N2O3/c13-10-7(11(15)12(10)16)3-6-1-2-9-8(4-6)14-5-17-9/h1-2,4,14H,3,5,13H2 |
| InChIKey | UFYREWNATVGQJK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|