C17H20N2O4S — CID 87748545
N-hydroxy-4-[[(4-propylphenyl)sulfonylamino]methyl]benzamide (PubChem CID 87748545) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-hydroxy-4-[[(4-propylphenyl)sulfonylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[(4-propylphenyl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 87748545 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-hydroxy-4-[[(4-propylphenyl)sulfonylamino]methyl]benzamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCc2ccc(C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-2-3-13-6-10-16(11-7-13)24(22,23)18-12-14-4-8-15(9-5-14)17(20)19-21/h4-11,18,21H,2-3,12H2,1H3,(H,19,20) |
| InChIKey | ITSPXYUVXLURGE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|