C20H20N2O5 — CID 87748558
[[3-(4-methoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoyl]amino] acetate (PubChem CID 87748558) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [[3-(4-methoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoyl]amino] acetate.
| Compound Name | [[3-(4-methoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoyl]amino] acetate |
|---|---|
| PubChem CID | 87748558 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [[3-(4-methoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoyl]amino] acetate |
| SMILES | COc1ccc(C(CC(=O)NOC(C)=O)N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-13(23)27-21-19(24)11-18(14-7-9-16(26-2)10-8-14)22-12-15-5-3-4-6-17(15)20(22)25/h3-10,18H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | XXLVWUVURFWRDH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|