C28H23Cl2F2N3O2 — CID 87749144
1-[2,6-dichloro-4-[(dimethylamino)methyl]phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-phenylmethoxycarbonimidoyl]pyridin-2-one (PubChem CID 87749144) has the molecular formula C28H23Cl2F2N3O2 and a molecular weight of 542.41 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-[(dimethylamino)methyl]phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-phenylmethoxycarbonimidoyl]pyridin-2-one.
| Compound Name | 1-[2,6-dichloro-4-[(dimethylamino)methyl]phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-phenylmethoxycarbonimidoyl]pyridin-2-one |
|---|---|
| PubChem CID | 87749144 |
| Molecular Formula | C28H23Cl2F2N3O2 |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-[2,6-dichloro-4-[(dimethylamino)methyl]phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-phenylmethoxycarbonimidoyl]pyridin-2-one |
| SMILES | CN(C)Cc1cc(Cl)c(-n2cc(/C(=N/OCc3ccccc3)c3ccc(F)cc3F)ccc2=O)c(Cl)c1 |
| InChI | InChI=1S/C28H23Cl2F2N3O2/c1-34(2)15-19-12-23(29)28(24(30)13-19)35-16-20(8-11-26(35)36)27(22-10-9-21(31)14-25(22)32)33-37-17-18-6-4-3-5-7-18/h3-14,16H,15,17H2,1-2H3/b33-27- |
| InChIKey | ZMKIVCLKTFKNEY-KGGMANCPSA-N |
| XLogP | 6.45 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|