C22H35N3O4 — CID 87749230
4-[1-[(2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]piperidin-4-yl]-N-hydroxybutanamide (PubChem CID 87749230) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-[1-[(2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]piperidin-4-yl]-N-hydroxybutanamide.
| Compound Name | 4-[1-[(2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]piperidin-4-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87749230 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 4-[1-[(2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]piperidin-4-yl]-N-hydroxybutanamide |
| SMILES | CC(C)(C)Oc1ccc(C[C@@H](N)C(=O)N2CCC(CCCC(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O4/c1-22(2,3)29-18-9-7-17(8-10-18)15-19(23)21(27)25-13-11-16(12-14-25)5-4-6-20(26)24-28/h7-10,16,19,28H,4-6,11-15,23H2,1-3H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | QDFXGRKGYHLGBK-LJQANCHMSA-N |
| XLogP | 2.65 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|