C15H24N2O5S — CID 87749528
(2S,3R)-2-amino-N,3-dihydroxy-N-[4-(2-methylbutan-2-yl)phenyl]sulfonylbutanamide (PubChem CID 87749528) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is (2S,3R)-2-amino-N,3-dihydroxy-N-[4-(2-methylbutan-2-yl)phenyl]sulfonylbutanamide.
| Compound Name | (2S,3R)-2-amino-N,3-dihydroxy-N-[4-(2-methylbutan-2-yl)phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 87749528 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S,3R)-2-amino-N,3-dihydroxy-N-[4-(2-methylbutan-2-yl)phenyl]sulfonylbutanamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)N(O)C(=O)[C@@H](N)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-5-15(3,4)11-6-8-12(9-7-11)23(21,22)17(20)14(19)13(16)10(2)18/h6-10,13,18,20H,5,16H2,1-4H3/t10-,13+/m1/s1 |
| InChIKey | GYSNKTLJPWWOAG-MFKMUULPSA-N |
| XLogP | 0.99 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|