About 3-azaniumylpropylazanium;methanesulfonate
3-azaniumylpropylazanium;methanesulfonate (PubChem CID 87750921) has the molecular formula C5H18N2O6S2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-azaniumylpropylazanium;methanesulfonate.
Molecular Properties
| Compound Name | 3-azaniumylpropylazanium;methanesulfonate |
| PubChem CID | 87750921 |
| Molecular Formula | C5H18N2O6S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-azaniumylpropylazanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[NH3+]CCC[NH3+] |
| InChI | InChI=1S/C3H10N2.2CH4O3S/c4-2-1-3-5;2*1-5(2,3)4/h1-5H2;2*1H3,(H,2,3,4) |
| InChIKey | XOXUKMGQTRROLJ-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 169.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-azaniumylpropylazanium;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azaniumylpropylazanium;methanesulfonate?
The IUPAC name of 3-azaniumylpropylazanium;methanesulfonate (CID 87750921) is 3-azaniumylpropylazanium;methanesulfonate.
What is the SMILES notation for 3-azaniumylpropylazanium;methanesulfonate?
The canonical SMILES for 3-azaniumylpropylazanium;methanesulfonate is CS(=O)(=O)[O-].CS(=O)(=O)[O-].[NH3+]CCC[NH3+].
What is the InChIKey of 3-azaniumylpropylazanium;methanesulfonate?
The InChIKey is XOXUKMGQTRROLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2.2CH4O3S/c4-2-1-3-5;2*1-5(2,3)4/h1-5H2;2*1H3,(H,2,3,4).
What are the key properties of 3-azaniumylpropylazanium;methanesulfonate?
3-azaniumylpropylazanium;methanesulfonate has a molecular weight of 266.34 g/mol, XLogP of -3.82, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azaniumylpropylazanium;methanesulfonate is sourced from PubChem (CID 87750921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).