About (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide
(NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 87750973) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 87750973 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cccc(C)c1/C=N/S(=O)C(C)(C)C |
| InChI | InChI=1S/C13H19NOS/c1-10-7-6-8-11(2)12(10)9-14-16(15)13(3,4)5/h6-9H,1-5H3/b14-9+ |
| InChIKey | DTWPSYJZCFDJIR-NTEUORMPSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide (CID 87750973) is (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide is Cc1cccc(C)c1/C=N/S(=O)C(C)(C)C.
What is the InChIKey of (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is DTWPSYJZCFDJIR-NTEUORMPSA-N. The full InChI is InChI=1S/C13H19NOS/c1-10-7-6-8-11(2)12(10)9-14-16(15)13(3,4)5/h6-9H,1-5H3/b14-9+.
What are the key properties of (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide?
(NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 237.37 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2,6-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 87750973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).