About (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate (PubChem CID 8775132) has the molecular formula C13H16N4OS2
and a molecular weight of 308.43 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate.
Molecular Properties
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate |
| PubChem CID | 8775132 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate |
| SMILES | N/C(=N\C1CCCC1)SCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C13H16N4OS2/c14-12(15-9-3-1-2-4-9)20-8-10-7-11(18)17-5-6-19-13(17)16-10/h5-7,9H,1-4,8H2,(H2,14,15) |
| InChIKey | WCLGTFUSKNUEMW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate?
The IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate (CID 8775132) is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate.
What is the SMILES notation for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate?
The canonical SMILES for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate is N/C(=N\C1CCCC1)SCc1cc(=O)n2ccsc2n1.
What is the InChIKey of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate?
The InChIKey is WCLGTFUSKNUEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4OS2/c14-12(15-9-3-1-2-4-9)20-8-10-7-11(18)17-5-6-19-13(17)16-10/h5-7,9H,1-4,8H2,(H2,14,15).
What are the key properties of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate?
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate has a molecular weight of 308.43 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N'-cyclopentylcarbamimidothioate is sourced from PubChem (CID 8775132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).