About 2H-chromene;iron;methane
2H-chromene;iron;methane (PubChem CID 87751507) has the molecular formula C10H12FeO
and a molecular weight of 204.05 g/mol. Its IUPAC name is 2H-chromene;iron;methane.
Molecular Properties
| Compound Name | 2H-chromene;iron;methane |
| PubChem CID | 87751507 |
| Molecular Formula | C10H12FeO |
| Molecular Weight | 204.05 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2H-chromene;iron;methane |
| SMILES | C.C1=Cc2ccccc2OC1.[Fe] |
| InChI | InChI=1S/C9H8O.CH4.Fe/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-6H,7H2;1H4; |
| InChIKey | WTHFITLXHALKIM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.05 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-chromene;iron;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;iron;methane?
The IUPAC name of 2H-chromene;iron;methane (CID 87751507) is 2H-chromene;iron;methane.
What is the SMILES notation for 2H-chromene;iron;methane?
The canonical SMILES for 2H-chromene;iron;methane is C.C1=Cc2ccccc2OC1.[Fe].
What is the InChIKey of 2H-chromene;iron;methane?
The InChIKey is WTHFITLXHALKIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.CH4.Fe/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-6H,7H2;1H4;.
What are the key properties of 2H-chromene;iron;methane?
2H-chromene;iron;methane has a molecular weight of 204.05 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;iron;methane is sourced from PubChem (CID 87751507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).