About (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate
(4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 8775174) has the molecular formula C15H12BrF3N2S
and a molecular weight of 389.24 g/mol. Its IUPAC name is (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
| PubChem CID | 8775174 |
| Molecular Formula | C15H12BrF3N2S |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | N/C(=N\c1ccccc1C(F)(F)F)SCc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrF3N2S/c16-11-7-5-10(6-8-11)9-22-14(20)21-13-4-2-1-3-12(13)15(17,18)19/h1-8H,9H2,(H2,20,21) |
| InChIKey | IAGBZVHDCZSLIL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The IUPAC name of (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate (CID 8775174) is (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate.
What is the SMILES notation for (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The canonical SMILES for (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate is N/C(=N\c1ccccc1C(F)(F)F)SCc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The InChIKey is IAGBZVHDCZSLIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrF3N2S/c16-11-7-5-10(6-8-11)9-22-14(20)21-13-4-2-1-3-12(13)15(17,18)19/h1-8H,9H2,(H2,20,21).
What are the key properties of (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
(4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate has a molecular weight of 389.24 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate is sourced from PubChem (CID 8775174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).