About 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride
1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride (PubChem CID 87751868) has the molecular formula C9H15Cl2Ti-
and a molecular weight of 241.99 g/mol. Its IUPAC name is 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride.
Molecular Properties
| Compound Name | 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride |
| PubChem CID | 87751868 |
| Molecular Formula | C9H15Cl2Ti- |
| Molecular Weight | 241.99 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride |
| SMILES | CCC1=C(CC)C[C-]=C1.Cl.Cl.[Ti] |
| InChI | InChI=1S/C9H13.2ClH.Ti/c1-3-8-6-5-7-9(8)4-2;;;/h6H,3-4,7H2,1-2H3;2*1H;/q-1;;; |
| InChIKey | PDWHTGOZOXDSPZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.99 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride?
The IUPAC name of 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride (CID 87751868) is 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride.
What is the SMILES notation for 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride?
The canonical SMILES for 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride is CCC1=C(CC)C[C-]=C1.Cl.Cl.[Ti].
What is the InChIKey of 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride?
The InChIKey is PDWHTGOZOXDSPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13.2ClH.Ti/c1-3-8-6-5-7-9(8)4-2;;;/h6H,3-4,7H2,1-2H3;2*1H;/q-1;;;.
What are the key properties of 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride?
1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride has a molecular weight of 241.99 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethylcyclopenta-1,3-diene;titanium;dihydrochloride is sourced from PubChem (CID 87751868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).