C29H29F8N5O7 — CID 87751873
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[2-[3-(dimethylamino)propylamino]-4-pyridinyl]methylamino]benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87751873) has the molecular formula C29H29F8N5O7 and a molecular weight of 711.56 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[2-[3-(dimethylamino)propylamino]-4-pyridinyl]methylamino]benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[2-[3-(dimethylamino)propylamino]-4-pyridinyl]methylamino]benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87751873 |
| Molecular Formula | C29H29F8N5O7 |
| Molecular Weight | 711.56 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[2-[3-(dimethylamino)propylamino]-4-pyridinyl]methylamino]benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCCNc1cc(CNc2ccccc2C(=O)Nc2ccc3c(c2)OC(F)(F)O3)ccn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H27F2N5O3.2C2HF3O2/c1-32(2)13-5-11-28-23-14-17(10-12-29-23)16-30-20-7-4-3-6-19(20)24(33)31-18-8-9-21-22(15-18)35-25(26,27)34-21;2*3-2(4,5)1(6)7/h3-4,6-10,12,14-15,30H,5,11,13,16H2,1-2H3,(H,28,29)(H,31,33);2*(H,6,7) |
| InChIKey | HNRPTZCNPOZCSQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|