About (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 8775190) has the molecular formula C17H14ClF3N2O2S
and a molecular weight of 402.83 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate.
Molecular Properties
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
| PubChem CID | 8775190 |
| Molecular Formula | C17H14ClF3N2O2S |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | N/C(=N\c1ccccc1C(F)(F)F)SCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C17H14ClF3N2O2S/c18-12-5-10-7-24-9-25-15(10)11(6-12)8-26-16(22)23-14-4-2-1-3-13(14)17(19,20)21/h1-6H,7-9H2,(H2,22,23) |
| InChIKey | IXZXHUCKOIONKW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate (CID 8775190) is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate.
What is the SMILES notation for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The canonical SMILES for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate is N/C(=N\c1ccccc1C(F)(F)F)SCc1cc(Cl)cc2c1OCOC2.
What is the InChIKey of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
The InChIKey is IXZXHUCKOIONKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClF3N2O2S/c18-12-5-10-7-24-9-25-15(10)11(6-12)8-26-16(22)23-14-4-2-1-3-13(14)17(19,20)21/h1-6H,7-9H2,(H2,22,23).
What are the key properties of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate?
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate has a molecular weight of 402.83 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate is sourced from PubChem (CID 8775190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).