C34H33N3O4 — CID 87752107
(2S,4E)-N-benzyl-1-(2,2-diphenylacetyl)-4-[(4-methoxyphenyl)methoxyimino]pyrrolidine-2-carboxamide (PubChem CID 87752107) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is (2S,4E)-N-benzyl-1-(2,2-diphenylacetyl)-4-[(4-methoxyphenyl)methoxyimino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-benzyl-1-(2,2-diphenylacetyl)-4-[(4-methoxyphenyl)methoxyimino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752107 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (2S,4E)-N-benzyl-1-(2,2-diphenylacetyl)-4-[(4-methoxyphenyl)methoxyimino]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CO/N=C2\C[C@@H](C(=O)NCc3ccccc3)N(C(=O)C(c3ccccc3)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C34H33N3O4/c1-40-30-19-17-26(18-20-30)24-41-36-29-21-31(33(38)35-22-25-11-5-2-6-12-25)37(23-29)34(39)32(27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,31-32H,21-24H2,1H3,(H,35,38)/b36-29+/t31-/m0/s1 |
| InChIKey | BMTXORUAJGVLCT-ZEYDKWTRSA-N |
| XLogP | 5.32 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|