About (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione
(4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione (PubChem CID 87752266) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione.
Molecular Properties
| Compound Name | (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione |
| PubChem CID | 87752266 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione |
| SMILES | C/C=C1/C(=O)OC(=O)C1=CCc1cc(C)oc1C |
| InChI | InChI=1S/C14H14O4/c1-4-11-12(14(16)18-13(11)15)6-5-10-7-8(2)17-9(10)3/h4,6-7H,5H2,1-3H3/b11-4+,12-6? |
| InChIKey | JLHVYMDNXASCHQ-IPWKSAMYSA-N |
| XLogP | 2.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione?
The IUPAC name of (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione (CID 87752266) is (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione.
What is the SMILES notation for (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione?
The canonical SMILES for (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione is C/C=C1/C(=O)OC(=O)C1=CCc1cc(C)oc1C.
What is the InChIKey of (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione?
The InChIKey is JLHVYMDNXASCHQ-IPWKSAMYSA-N. The full InChI is InChI=1S/C14H14O4/c1-4-11-12(14(16)18-13(11)15)6-5-10-7-8(2)17-9(10)3/h4,6-7H,5H2,1-3H3/b11-4+,12-6?.
What are the key properties of (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione?
(4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione has a molecular weight of 246.26 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-[2-(2,5-dimethylfuran-3-yl)ethylidene]-4-ethylideneoxolane-2,5-dione is sourced from PubChem (CID 87752266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).