C11H20O2S — CID 87752815
(1R,2R,3S,5R)-6,6-dimethyl-2-(2-sulfanylethyl)bicyclo[3.1.1]heptane-2,3-diol (PubChem CID 87752815) has the molecular formula C11H20O2S and a molecular weight of 216.35 g/mol. Its IUPAC name is (1R,2R,3S,5R)-6,6-dimethyl-2-(2-sulfanylethyl)bicyclo[3.1.1]heptane-2,3-diol.
| Compound Name | (1R,2R,3S,5R)-6,6-dimethyl-2-(2-sulfanylethyl)bicyclo[3.1.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 87752815 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1R,2R,3S,5R)-6,6-dimethyl-2-(2-sulfanylethyl)bicyclo[3.1.1]heptane-2,3-diol |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@](O)(CCS)[C@@H](O)C2 |
| InChI | InChI=1S/C11H20O2S/c1-10(2)7-5-8(10)11(13,3-4-14)9(12)6-7/h7-9,12-14H,3-6H2,1-2H3/t7-,8-,9+,11-/m1/s1 |
| InChIKey | AYVZPLUJQWZVEF-SDNRWEOFSA-N |
| XLogP | 1.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|