About 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine
2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine (PubChem CID 87753124) has the molecular formula C20H13ClN6
and a molecular weight of 372.82 g/mol. Its IUPAC name is 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine.
Molecular Properties
| Compound Name | 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine |
| PubChem CID | 87753124 |
| Molecular Formula | C20H13ClN6 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine |
| SMILES | Clc1nc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C20H13ClN6/c21-20-26-17(16-18(27-20)23-11-22-16)19-24-14(12-7-3-1-4-8-12)15(25-19)13-9-5-2-6-10-13/h1-11H,(H,24,25)(H,22,23,26,27) |
| InChIKey | UDMPAFPKJIWQOG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine?
The IUPAC name of 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine (CID 87753124) is 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine.
What is the SMILES notation for 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine?
The canonical SMILES for 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine is Clc1nc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c2[nH]cnc2n1.
What is the InChIKey of 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine?
The InChIKey is UDMPAFPKJIWQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClN6/c21-20-26-17(16-18(27-20)23-11-22-16)19-24-14(12-7-3-1-4-8-12)15(25-19)13-9-5-2-6-10-13/h1-11H,(H,24,25)(H,22,23,26,27).
What are the key properties of 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine?
2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine has a molecular weight of 372.82 g/mol, XLogP of 4.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(4,5-diphenyl-1H-imidazol-2-yl)-7H-purine is sourced from PubChem (CID 87753124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).