C16H11Br7 — CID 87753356
1,2,4,5-tetrabromo-3-methyl-6-[2-(2,3,5-tribromo-4-methylphenyl)ethyl]benzene (PubChem CID 87753356) has the molecular formula C16H11Br7 and a molecular weight of 762.59 g/mol. Its IUPAC name is 1,2,4,5-tetrabromo-3-methyl-6-[2-(2,3,5-tribromo-4-methylphenyl)ethyl]benzene.
| Compound Name | 1,2,4,5-tetrabromo-3-methyl-6-[2-(2,3,5-tribromo-4-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 87753356 |
| Molecular Formula | C16H11Br7 |
| Molecular Weight | 762.59 g/mol |
| Exact Mass | 755.51 |
| IUPAC Name | 1,2,4,5-tetrabromo-3-methyl-6-[2-(2,3,5-tribromo-4-methylphenyl)ethyl]benzene |
| SMILES | Cc1c(Br)cc(CCc2c(Br)c(Br)c(C)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C16H11Br7/c1-6-10(17)5-8(14(21)11(6)18)3-4-9-15(22)12(19)7(2)13(20)16(9)23/h5H,3-4H2,1-2H3 |
| InChIKey | MVPMTFGLRPMQLT-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.59 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|