C46H48N2O2 — CID 87754027
1,2-bis[2,6-di(propan-2-yl)phenyl]perylene-3-carboxamide;formamide (PubChem CID 87754027) has the molecular formula C46H48N2O2 and a molecular weight of 660.90 g/mol. Its IUPAC name is 1,2-bis[2,6-di(propan-2-yl)phenyl]perylene-3-carboxamide;formamide.
| Compound Name | 1,2-bis[2,6-di(propan-2-yl)phenyl]perylene-3-carboxamide;formamide |
|---|---|
| PubChem CID | 87754027 |
| Molecular Formula | C46H48N2O2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 1,2-bis[2,6-di(propan-2-yl)phenyl]perylene-3-carboxamide;formamide |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1c(C(N)=O)c2cccc3c4cccc5cccc(c(c1-c1c(C(C)C)cccc1C(C)C)c23)c54.NC=O |
| InChI | InChI=1S/C45H45NO.CH3NO/c1-24(2)29-16-11-17-30(25(3)4)38(29)43-41-35-22-10-15-28-14-9-20-33(37(28)35)34-21-13-23-36(40(34)41)42(45(46)47)44(43)39-31(26(5)6)18-12-19-32(39)27(7)8;2-1-3/h9-27H,1-8H3,(H2,46,47);1H,(H2,2,3) |
| InChIKey | OOUBHYYGVADVTP-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|