About 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate
2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate (PubChem CID 87754910) has the molecular formula C22H35NO5
and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate.
Molecular Properties
| Compound Name | 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate |
| PubChem CID | 87754910 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate |
| SMILES | CCNCCOCCOC(=O)Oc1c(C)c(C)cc(C)c1C(C)(C)CC(C)=O |
| InChI | InChI=1S/C22H35NO5/c1-8-23-9-10-26-11-12-27-21(25)28-20-18(5)15(2)13-16(3)19(20)22(6,7)14-17(4)24/h13,23H,8-12,14H2,1-7H3 |
| InChIKey | UKHOYOQOSRZODE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate?
The IUPAC name of 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate (CID 87754910) is 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate.
What is the SMILES notation for 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate?
The canonical SMILES for 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate is CCNCCOCCOC(=O)Oc1c(C)c(C)cc(C)c1C(C)(C)CC(C)=O.
What is the InChIKey of 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate?
The InChIKey is UKHOYOQOSRZODE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO5/c1-8-23-9-10-26-11-12-27-21(25)28-20-18(5)15(2)13-16(3)19(20)22(6,7)14-17(4)24/h13,23H,8-12,14H2,1-7H3.
What are the key properties of 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate?
2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate has a molecular weight of 393.52 g/mol, XLogP of 4.01, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(ethylamino)ethoxy]ethyl [2,3,5-trimethyl-6-(2-methyl-4-oxopentan-2-yl)phenyl] carbonate is sourced from PubChem (CID 87754910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).